C31H35N3O3 — CID 10228621
(4-phenylphenyl)methyl 2-(7-aminoheptanoylamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 10228621) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is (4-phenylphenyl)methyl 2-(7-aminoheptanoylamino)-3-(1H-indol-3-yl)propanoate.
| Compound Name | (4-phenylphenyl)methyl 2-(7-aminoheptanoylamino)-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 10228621 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (4-phenylphenyl)methyl 2-(7-aminoheptanoylamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | NCCCCCCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H35N3O3/c32-19-9-2-1-6-14-30(35)34-29(20-26-21-33-28-13-8-7-12-27(26)28)31(36)37-22-23-15-17-25(18-16-23)24-10-4-3-5-11-24/h3-5,7-8,10-13,15-18,21,29,33H,1-2,6,9,14,19-20,22,32H2,(H,34,35) |
| InChIKey | UVCCCKBFJOCEAF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|