C48H61N7O6 — CID 161298173
benzyl (2S)-2-[[(2S)-2,6-diaminohexyl]amino]-3-(1H-indol-3-yl)propanoate;[(2S)-3-(1H-indol-3-yl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2,6-diaminohexanoate (PubChem CID 161298173) has the molecular formula C48H61N7O6 and a molecular weight of 832.06 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2,6-diaminohexyl]amino]-3-(1H-indol-3-yl)propanoate;[(2S)-3-(1H-indol-3-yl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2,6-diaminohexanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2,6-diaminohexyl]amino]-3-(1H-indol-3-yl)propanoate;[(2S)-3-(1H-indol-3-yl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 161298173 |
| Molecular Formula | C48H61N7O6 |
| Molecular Weight | 832.06 g/mol |
| Exact Mass | 831.47 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2,6-diaminohexyl]amino]-3-(1H-indol-3-yl)propanoate;[(2S)-3-(1H-indol-3-yl)-1-oxo-1-phenylmethoxypropan-2-yl] (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)O[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1.NCCCC[C@H](N)CN[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H32N4O2.C24H29N3O4/c25-13-7-6-10-20(26)16-28-23(24(29)30-17-18-8-2-1-3-9-18)14-19-15-27-22-12-5-4-11-21(19)22;25-13-7-6-11-20(26)23(28)31-22(24(29)30-16-17-8-2-1-3-9-17)14-18-15-27-21-12-5-4-10-19(18)21/h1-5,8-9,11-12,15,20,23,27-28H,6-7,10,13-14,16-17,25-26H2;1-5,8-10,12,15,20,22,27H,6-7,11,13-14,16,25-26H2/t20-,23-;20-,22-/m00/s1 |
| InChIKey | VHGFQOUKUDAVSV-GNTCXZLTSA-N |
| XLogP | 5.69 |
| TPSA | 226.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|