C17H18NO3+ — CID 102287398
benzylidene-[(3,4-dimethoxyphenyl)methyl]-formylazanium (PubChem CID 102287398) has the molecular formula C17H18NO3+ and a molecular weight of 284.34 g/mol. Its IUPAC name is benzylidene-[(3,4-dimethoxyphenyl)methyl]-formylazanium.
| Compound Name | benzylidene-[(3,4-dimethoxyphenyl)methyl]-formylazanium |
|---|---|
| PubChem CID | 102287398 |
| Molecular Formula | C17H18NO3+ |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | benzylidene-[(3,4-dimethoxyphenyl)methyl]-formylazanium |
| SMILES | COc1ccc(C/[N+](C=O)=C/c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H18NO3/c1-20-16-9-8-15(10-17(16)21-2)12-18(13-19)11-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3/q+1/b18-11- |
| InChIKey | VIWPUGFAQYBFTR-WQRHYEAKSA-N |
| XLogP | 2.49 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|