C17H17NO4 — CID 141270318
(2E)-2-[(3,4-dimethoxyphenyl)methoxyimino]-1-phenylethanone (PubChem CID 141270318) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2E)-2-[(3,4-dimethoxyphenyl)methoxyimino]-1-phenylethanone.
| Compound Name | (2E)-2-[(3,4-dimethoxyphenyl)methoxyimino]-1-phenylethanone |
|---|---|
| PubChem CID | 141270318 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (2E)-2-[(3,4-dimethoxyphenyl)methoxyimino]-1-phenylethanone |
| SMILES | COc1ccc(CO/N=C/C(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C17H17NO4/c1-20-16-9-8-13(10-17(16)21-2)12-22-18-11-15(19)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3/b18-11+ |
| InChIKey | VQWCBFAAFRKODC-WOJGMQOQSA-N |
| XLogP | 3.09 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|