C20H20F3NO2 — CID 102287818
N-benzyl-N-[(2S,3S)-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-yl]hydroxylamine (PubChem CID 102287818) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is N-benzyl-N-[(2S,3S)-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[(2S,3S)-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-yl]hydroxylamine |
|---|---|
| PubChem CID | 102287818 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-benzyl-N-[(2S,3S)-6,6,6-trifluoro-2-phenylmethoxyhex-4-yn-3-yl]hydroxylamine |
| SMILES | C[C@H](OCc1ccccc1)[C@H](C#CC(F)(F)F)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H20F3NO2/c1-16(26-15-18-10-6-3-7-11-18)19(12-13-20(21,22)23)24(25)14-17-8-4-2-5-9-17/h2-11,16,19,25H,14-15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | ZRQDKYRBKBLACX-LPHOPBHVSA-N |
| XLogP | 4.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|