C31H42F3NO2Si — CID 162412727
3-[(2R,4R,5R)-3-benzyl-4-(phenylmethoxymethyl)-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 162412727) has the molecular formula C31H42F3NO2Si and a molecular weight of 545.76 g/mol. Its IUPAC name is 3-[(2R,4R,5R)-3-benzyl-4-(phenylmethoxymethyl)-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,4R,5R)-3-benzyl-4-(phenylmethoxymethyl)-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 162412727 |
| Molecular Formula | C31H42F3NO2Si |
| Molecular Weight | 545.76 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 3-[(2R,4R,5R)-3-benzyl-4-(phenylmethoxymethyl)-2-(trifluoromethyl)-1,3-oxazolidin-5-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC[C@H]1O[C@H](C(F)(F)F)N(Cc2ccccc2)[C@@H]1COCc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H42F3NO2Si/c1-23(2)38(24(3)4,25(5)6)19-13-18-29-28(22-36-21-27-16-11-8-12-17-27)35(30(37-29)31(32,33)34)20-26-14-9-7-10-15-26/h7-12,14-17,23-25,28-30H,18,20-22H2,1-6H3/t28-,29-,30-/m1/s1 |
| InChIKey | MRGLGNPFLDPWRY-IDZRBWSNSA-N |
| XLogP | 7.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.76 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|