2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid

C18H12N2O5 — CID 102287893

IUPAC2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid
SMILESCOc1ccc2nc(C(=O)O)c3c4cc(C(=O)O)ccc4[nH]c3c2c1
InChIInChI=1S/C18H12N2O5/c1-25-9-3-5-13-11(7-9)15-14(16(20-13)18(23)24)10-6-8(17(21)22)2-4-12(10)19-15/h2-7,19H,1H3,(H,21,22)(H,23,24)
InChIKeyKGOXFELHDDUXPA-UHFFFAOYSA-N
MW336.30 g/mol
LogP3.27
Rot. Bonds3

About 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid

2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid (PubChem CID 102287893) has the molecular formula C18H12N2O5 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid.

Molecular Properties

Compound Name2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid
PubChem CID102287893
Molecular FormulaC18H12N2O5
Molecular Weight336.30 g/mol
Exact Mass336.07
IUPAC Name2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid
SMILESCOc1ccc2nc(C(=O)O)c3c4cc(C(=O)O)ccc4[nH]c3c2c1
InChIInChI=1S/C18H12N2O5/c1-25-9-3-5-13-11(7-9)15-14(16(20-13)18(23)24)10-6-8(17(21)22)2-4-12(10)19-15/h2-7,19H,1H3,(H,21,22)(H,23,24)
InChIKeyKGOXFELHDDUXPA-UHFFFAOYSA-N
XLogP3.27
TPSA112.51 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.30
LogP ≤ 53.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The IUPAC name of 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid (CID 102287893) is 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid.
What is the SMILES notation for 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The canonical SMILES for 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid is COc1ccc2nc(C(=O)O)c3c4cc(C(=O)O)ccc4[nH]c3c2c1.
What is the InChIKey of 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
The InChIKey is KGOXFELHDDUXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O5/c1-25-9-3-5-13-11(7-9)15-14(16(20-13)18(23)24)10-6-8(17(21)22)2-4-12(10)19-15/h2-7,19H,1H3,(H,21,22)(H,23,24).
What are the key properties of 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid?
2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid has a molecular weight of 336.30 g/mol, XLogP of 3.27, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-11H-indolo[3,2-c]quinoline-6,8-dicarboxylic acid is sourced from PubChem (CID 102287893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).