C17H11FN2O3 — CID 122181016
10-fluoro-3-methoxy-11H-indolo[3,2-c]quinoline-6-carboxylic acid (PubChem CID 122181016) has the molecular formula C17H11FN2O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is 10-fluoro-3-methoxy-11H-indolo[3,2-c]quinoline-6-carboxylic acid.
| Compound Name | 10-fluoro-3-methoxy-11H-indolo[3,2-c]quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 122181016 |
| Molecular Formula | C17H11FN2O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 10-fluoro-3-methoxy-11H-indolo[3,2-c]quinoline-6-carboxylic acid |
| SMILES | COc1ccc2c(c1)nc(C(=O)O)c1c3cccc(F)c3[nH]c21 |
| InChI | InChI=1S/C17H11FN2O3/c1-23-8-5-6-9-12(7-8)19-16(17(21)22)13-10-3-2-4-11(18)14(10)20-15(9)13/h2-7,20H,1H3,(H,21,22) |
| InChIKey | UWOGNCRXEQLSQQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |