C22H52OSi5 — CID 102289898
tert-butyl-[(2S)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-dimethylsilane (PubChem CID 102289898) has the molecular formula C22H52OSi5 and a molecular weight of 473.09 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-dimethylsilane |
|---|---|
| PubChem CID | 102289898 |
| Molecular Formula | C22H52OSi5 |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | tert-butyl-[(2S)-2-tert-butyl-1,1-bis(trimethylsilyl)-2-trimethylsilyloxysilet-3-yl]-dimethylsilane |
| SMILES | CC(C)(C)[C@@]1(O[Si](C)(C)C)C([Si](C)(C)C(C)(C)C)=C[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H52OSi5/c1-20(2,3)22(23-24(7,8)9)19(27(16,17)21(4,5)6)18-28(22,25(10,11)12)26(13,14)15/h18H,1-17H3/t22-/m1/s1 |
| InChIKey | YSOASFPXRAADCC-JOCHJYFZSA-N |
| XLogP | 7.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|