C24H23NO — CID 102291766
1-(3-tert-butyl-1-phenylcarbazol-9-yl)ethanone (PubChem CID 102291766) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-phenylcarbazol-9-yl)ethanone.
| Compound Name | 1-(3-tert-butyl-1-phenylcarbazol-9-yl)ethanone |
|---|---|
| PubChem CID | 102291766 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-(3-tert-butyl-1-phenylcarbazol-9-yl)ethanone |
| SMILES | CC(=O)n1c2ccccc2c2cc(C(C)(C)C)cc(-c3ccccc3)c21 |
| InChI | InChI=1S/C24H23NO/c1-16(26)25-22-13-9-8-12-19(22)21-15-18(24(2,3)4)14-20(23(21)25)17-10-6-5-7-11-17/h5-15H,1-4H3 |
| InChIKey | JEHMSTAECZFART-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |