C16H17ClO5 — CID 102293432
dimethyl (4S,5S)-10-chloro-4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate (PubChem CID 102293432) has the molecular formula C16H17ClO5 and a molecular weight of 324.76 g/mol. Its IUPAC name is dimethyl (4S,5S)-10-chloro-4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate.
| Compound Name | dimethyl (4S,5S)-10-chloro-4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102293432 |
| Molecular Formula | C16H17ClO5 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | dimethyl (4S,5S)-10-chloro-4-ethenyl-8-oxospiro[4.5]deca-6,9-diene-2,2-dicarboxylate |
| SMILES | C=C[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@]12C=CC(=O)C=C2Cl |
| InChI | InChI=1S/C16H17ClO5/c1-4-10-8-16(13(19)21-2,14(20)22-3)9-15(10)6-5-11(18)7-12(15)17/h4-7,10H,1,8-9H2,2-3H3/t10-,15-/m1/s1 |
| InChIKey | CIPZZKLMAHFFTK-MEBBXXQBSA-N |
| XLogP | 2.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|