C15H19ClO4 — CID 11066469
dimethyl (3R,3aR,6S,7aR)-6-chloro-3-ethenyl-2,3,3a,6,7,7a-hexahydroindene-1,1-dicarboxylate (PubChem CID 11066469) has the molecular formula C15H19ClO4 and a molecular weight of 298.77 g/mol. Its IUPAC name is dimethyl (3R,3aR,6S,7aR)-6-chloro-3-ethenyl-2,3,3a,6,7,7a-hexahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl (3R,3aR,6S,7aR)-6-chloro-3-ethenyl-2,3,3a,6,7,7a-hexahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11066469 |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | dimethyl (3R,3aR,6S,7aR)-6-chloro-3-ethenyl-2,3,3a,6,7,7a-hexahydroindene-1,1-dicarboxylate |
| SMILES | C=C[C@H]1CC(C(=O)OC)(C(=O)OC)[C@@H]2C[C@H](Cl)C=C[C@@H]21 |
| InChI | InChI=1S/C15H19ClO4/c1-4-9-8-15(13(17)19-2,14(18)20-3)12-7-10(16)5-6-11(9)12/h4-6,9-12H,1,7-8H2,2-3H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | ZOJYPPFSPAPQTM-IRCOFANPSA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|