C22H23NO4S — CID 102293723
ethyl 2-[(1S,2S,5R)-2-(benzenesulfonyl)-2-cyano-5-phenylcyclopentyl]acetate (PubChem CID 102293723) has the molecular formula C22H23NO4S and a molecular weight of 397.50 g/mol. Its IUPAC name is ethyl 2-[(1S,2S,5R)-2-(benzenesulfonyl)-2-cyano-5-phenylcyclopentyl]acetate.
| Compound Name | ethyl 2-[(1S,2S,5R)-2-(benzenesulfonyl)-2-cyano-5-phenylcyclopentyl]acetate |
|---|---|
| PubChem CID | 102293723 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 2-[(1S,2S,5R)-2-(benzenesulfonyl)-2-cyano-5-phenylcyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](c2ccccc2)CC[C@]1(C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4S/c1-2-27-21(24)15-20-19(17-9-5-3-6-10-17)13-14-22(20,16-23)28(25,26)18-11-7-4-8-12-18/h3-12,19-20H,2,13-15H2,1H3/t19-,20-,22+/m0/s1 |
| InChIKey | WLZKAGDLGZTFKP-JAXLGGSGSA-N |
| XLogP | 3.87 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |