C18H25NO2 — CID 102295144
tert-butyl (5R)-5-benzyl-3-ethyl-1,2-dihydropyrrole-5-carboxylate (PubChem CID 102295144) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl (5R)-5-benzyl-3-ethyl-1,2-dihydropyrrole-5-carboxylate.
| Compound Name | tert-butyl (5R)-5-benzyl-3-ethyl-1,2-dihydropyrrole-5-carboxylate |
|---|---|
| PubChem CID | 102295144 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl (5R)-5-benzyl-3-ethyl-1,2-dihydropyrrole-5-carboxylate |
| SMILES | CCC1=C[C@](Cc2ccccc2)(C(=O)OC(C)(C)C)NC1 |
| InChI | InChI=1S/C18H25NO2/c1-5-14-11-18(19-13-14,16(20)21-17(2,3)4)12-15-9-7-6-8-10-15/h6-11,19H,5,12-13H2,1-4H3/t18-/m0/s1 |
| InChIKey | HZHXQXXNQJTYOB-SFHVURJKSA-N |
| XLogP | 3.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|