C16H20O3 — CID 102296341
(4S,5R)-4-benzyl-4-hydroxy-7-oxaspiro[4.5]decan-6-one (PubChem CID 102296341) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (4S,5R)-4-benzyl-4-hydroxy-7-oxaspiro[4.5]decan-6-one.
| Compound Name | (4S,5R)-4-benzyl-4-hydroxy-7-oxaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 102296341 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4S,5R)-4-benzyl-4-hydroxy-7-oxaspiro[4.5]decan-6-one |
| SMILES | O=C1OCCC[C@@]12CCC[C@]2(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H20O3/c17-14-15(9-5-11-19-14)8-4-10-16(15,18)12-13-6-2-1-3-7-13/h1-3,6-7,18H,4-5,8-12H2/t15-,16-/m0/s1 |
| InChIKey | HWDUJWVQIRMSJX-HOTGVXAUSA-N |
| XLogP | 2.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |