C54H38Br2F12N4 — CID 102296621
(1Z,4Z,10Z,14Z)-22,24-bis(3-bromopropyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-21,23-dihydroporphyrin (PubChem CID 102296621) has the molecular formula C54H38Br2F12N4 and a molecular weight of 1130.71 g/mol. Its IUPAC name is (1Z,4Z,10Z,14Z)-22,24-bis(3-bromopropyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-21,23-dihydroporphyrin.
| Compound Name | (1Z,4Z,10Z,14Z)-22,24-bis(3-bromopropyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 102296621 |
| Molecular Formula | C54H38Br2F12N4 |
| Molecular Weight | 1130.71 g/mol |
| Exact Mass | 1128.13 |
| IUPAC Name | (1Z,4Z,10Z,14Z)-22,24-bis(3-bromopropyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-21,23-dihydroporphyrin |
| SMILES | FC(F)(F)c1c(C(F)(F)F)c2n(CCCBr)c1/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1c(C(F)(F)F)c(C(F)(F)F)c(n1CCCBr)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C54H38Br2F12N4/c55-27-13-29-71-47-39(31-15-5-1-6-16-31)35-23-24-36(69-35)40(32-17-7-2-8-18-32)49-45(53(63,64)65)46(54(66,67)68)50(72(49)30-14-28-56)42(34-21-11-4-12-22-34)38-26-25-37(70-38)41(33-19-9-3-10-20-33)48(71)44(52(60,61)62)43(47)51(57,58)59/h1-12,15-26,69-70H,13-14,27-30H2/b39-35-,40-36-,41-37-,42-38-,47-39-,48-41-,49-40-,50-42- |
| InChIKey | NXYQTPIZAKKJOP-YORGVJJOSA-N |
| XLogP | 12.89 |
| TPSA | 41.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1130.71 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|