C52H35BrF12N4 — CID 137284930
(1Z,4Z,10Z,14Z)-24-(4-bromobutyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-22,23-dihydro-21H-porphyrin (PubChem CID 137284930) has the molecular formula C52H35BrF12N4 and a molecular weight of 1023.76 g/mol. Its IUPAC name is (1Z,4Z,10Z,14Z)-24-(4-bromobutyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-22,23-dihydro-21H-porphyrin.
| Compound Name | (1Z,4Z,10Z,14Z)-24-(4-bromobutyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-22,23-dihydro-21H-porphyrin |
|---|---|
| PubChem CID | 137284930 |
| Molecular Formula | C52H35BrF12N4 |
| Molecular Weight | 1023.76 g/mol |
| Exact Mass | 1022.19 |
| IUPAC Name | (1Z,4Z,10Z,14Z)-24-(4-bromobutyl)-5,10,15,20-tetraphenyl-7,8,17,18-tetrakis(trifluoromethyl)-22,23-dihydro-21H-porphyrin |
| SMILES | FC(F)(F)c1c2[nH]c(c1C(F)(F)F)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1c(C(F)(F)F)c(C(F)(F)F)c(n1CCCCBr)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C52H35BrF12N4/c53-27-13-14-28-69-47-39(31-19-9-3-10-20-31)35-25-23-33(66-35)37(29-15-5-1-6-16-29)45-41(49(54,55)56)42(50(57,58)59)46(68-45)38(30-17-7-2-8-18-30)34-24-26-36(67-34)40(32-21-11-4-12-22-32)48(69)44(52(63,64)65)43(47)51(60,61)62/h1-12,15-26,66-68H,13-14,27-28H2/b37-33-,38-34-,39-35-,40-36-,45-37-,46-38-,47-39-,48-40- |
| InChIKey | OIMOTTGMYJUCMJ-HHCYEGAWSA-N |
| XLogP | 12.03 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.76 |
| LogP ≤ 5 | 12.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|