C44H18F15N5 — CID 91079691
4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline (PubChem CID 91079691) has the molecular formula C44H18F15N5 and a molecular weight of 901.63 g/mol. Its IUPAC name is 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline.
| Compound Name | 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 91079691 |
| Molecular Formula | C44H18F15N5 |
| Molecular Weight | 901.63 g/mol |
| Exact Mass | 901.13 |
| IUPAC Name | 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]aniline |
| SMILES | Nc1ccc(C2=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C44H18F15N5/c45-30-27(31(46)37(52)42(57)36(30)51)24-17-7-5-15(61-17)23(13-1-3-14(60)4-2-13)16-6-8-18(62-16)25(28-32(47)38(53)43(58)39(54)33(28)48)20-10-12-22(64-20)26(21-11-9-19(24)63-21)29-34(49)40(55)44(59)41(56)35(29)50/h1-12,61-64H,60H2 |
| InChIKey | GZDIJKCBQGSDBS-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.63 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|