C30H32N4O5 — CID 102303996
dimethyl (2S,4R)-7-methyl-9-oxo-3-(2-phenylethyl)-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate (PubChem CID 102303996) has the molecular formula C30H32N4O5 and a molecular weight of 528.61 g/mol. Its IUPAC name is dimethyl (2S,4R)-7-methyl-9-oxo-3-(2-phenylethyl)-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate.
| Compound Name | dimethyl (2S,4R)-7-methyl-9-oxo-3-(2-phenylethyl)-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 102303996 |
| Molecular Formula | C30H32N4O5 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | dimethyl (2S,4R)-7-methyl-9-oxo-3-(2-phenylethyl)-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate |
| SMILES | COC(=O)C12CN(C)CC(C(=O)OC)(C1=O)[C@@H](c1ccccn1)N(CCc1ccccc1)[C@H]2c1ccccn1 |
| InChI | InChI=1S/C30H32N4O5/c1-33-19-29(27(36)38-2)24(22-13-7-9-16-31-22)34(18-15-21-11-5-4-6-12-21)25(23-14-8-10-17-32-23)30(20-33,26(29)35)28(37)39-3/h4-14,16-17,24-25H,15,18-20H2,1-3H3/t24-,25+,29?,30? |
| InChIKey | NRTOPIATMLFMKN-WLJAODTFSA-N |
| XLogP | 2.65 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|