C25H28N4O9 — CID 46905522
dimethyl 3,7-dimethyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate;oxalic acid (PubChem CID 46905522) has the molecular formula C25H28N4O9 and a molecular weight of 528.52 g/mol. Its IUPAC name is dimethyl 3,7-dimethyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate;oxalic acid.
| Compound Name | dimethyl 3,7-dimethyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate;oxalic acid |
|---|---|
| PubChem CID | 46905522 |
| Molecular Formula | C25H28N4O9 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | dimethyl 3,7-dimethyl-9-oxo-2,4-dipyridin-2-yl-3,7-diazabicyclo[3.3.1]nonane-1,5-dicarboxylate;oxalic acid |
| SMILES | COC(=O)C12CN(C)CC(C(=O)OC)(C1=O)C(c1ccccn1)N(C)C2c1ccccn1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H26N4O5.C2H2O4/c1-26-13-22(20(29)31-3)17(15-9-5-7-11-24-15)27(2)18(16-10-6-8-12-25-16)23(14-26,19(22)28)21(30)32-4;3-1(4)2(5)6/h5-12,17-18H,13-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | JHASZXNDLSKXJA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|