C29H66O5Si4 — CID 102304391
(2S,3R,4S)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]pentanal (PubChem CID 102304391) has the molecular formula C29H66O5Si4 and a molecular weight of 607.19 g/mol. Its IUPAC name is (2S,3R,4S)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]pentanal.
| Compound Name | (2S,3R,4S)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]pentanal |
|---|---|
| PubChem CID | 102304391 |
| Molecular Formula | C29H66O5Si4 |
| Molecular Weight | 607.19 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | (2S,3R,4S)-2,3,4,5-tetrakis[[tert-butyl(dimethyl)silyl]oxy]pentanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H66O5Si4/c1-26(2,3)35(13,14)31-22-24(33-37(17,18)28(7,8)9)25(34-38(19,20)29(10,11)12)23(21-30)32-36(15,16)27(4,5)6/h21,23-25H,22H2,1-20H3/t23-,24+,25+/m1/s1 |
| InChIKey | ZBLHJISHEGHMOL-DSITVLBTSA-N |
| XLogP | 9.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.19 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|