C24H51F3O4Si3 — CID 11620881
(2S,3R,5R)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexanal (PubChem CID 11620881) has the molecular formula C24H51F3O4Si3 and a molecular weight of 544.92 g/mol. Its IUPAC name is (2S,3R,5R)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexanal.
| Compound Name | (2S,3R,5R)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexanal |
|---|---|
| PubChem CID | 11620881 |
| Molecular Formula | C24H51F3O4Si3 |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | (2S,3R,5R)-2,3,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6,6,6-trifluorohexanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C=O)[C@@H](C[C@@H](O[Si](C)(C)C(C)(C)C)C(F)(F)F)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H51F3O4Si3/c1-21(2,3)32(10,11)29-18(19(17-28)30-33(12,13)22(4,5)6)16-20(24(25,26)27)31-34(14,15)23(7,8)9/h17-20H,16H2,1-15H3/t18-,19-,20-/m1/s1 |
| InChIKey | RIOATJCJQTXGAX-VAMGGRTRSA-N |
| XLogP | 8.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|