C33H76O6Si5 — CID 102304393
(2S,3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-trimethylsilyloxyhexanal (PubChem CID 102304393) has the molecular formula C33H76O6Si5 and a molecular weight of 709.39 g/mol. Its IUPAC name is (2S,3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-trimethylsilyloxyhexanal.
| Compound Name | (2S,3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-trimethylsilyloxyhexanal |
|---|---|
| PubChem CID | 102304393 |
| Molecular Formula | C33H76O6Si5 |
| Molecular Weight | 709.39 g/mol |
| Exact Mass | 708.45 |
| IUPAC Name | (2S,3S,4R,5S)-3,4,5,6-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-2-trimethylsilyloxyhexanal |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C33H76O6Si5/c1-30(2,3)41(16,17)35-25-27(37-42(18,19)31(4,5)6)29(39-44(22,23)33(10,11)12)28(26(24-34)36-40(13,14)15)38-43(20,21)32(7,8)9/h24,26-29H,25H2,1-23H3/t26-,27+,28-,29-/m1/s1 |
| InChIKey | BDUGWCUKZZSUHD-VJLHXPKFSA-N |
| XLogP | 10.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.39 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|