C40H31N5O2 — CID 102311650
4-[bis[4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)phenyl]methyl]benzonitrile (PubChem CID 102311650) has the molecular formula C40H31N5O2 and a molecular weight of 613.72 g/mol. Its IUPAC name is 4-[bis[4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)phenyl]methyl]benzonitrile.
| Compound Name | 4-[bis[4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 102311650 |
| Molecular Formula | C40H31N5O2 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | 4-[bis[4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)phenyl]methyl]benzonitrile |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1-c1ccc(C(c2ccc(C#N)cc2)c2ccc(-c3c(C)[nH]n(-c4ccccc4)c3=O)cc2)cc1 |
| InChI | InChI=1S/C40H31N5O2/c1-26-36(39(46)44(42-26)34-9-5-3-6-10-34)29-17-21-32(22-18-29)38(31-15-13-28(25-41)14-16-31)33-23-19-30(20-24-33)37-27(2)43-45(40(37)47)35-11-7-4-8-12-35/h3-24,38,42-43H,1-2H3 |
| InChIKey | VFGSGHTUJKHEQU-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|