C16H12N4OS — CID 156860155
4-[5-methyl-3-oxo-2-(5-sulfanyl-2-pyridinyl)-1H-pyrazol-4-yl]benzonitrile (PubChem CID 156860155) has the molecular formula C16H12N4OS and a molecular weight of 308.37 g/mol. Its IUPAC name is 4-[5-methyl-3-oxo-2-(5-sulfanyl-2-pyridinyl)-1H-pyrazol-4-yl]benzonitrile.
| Compound Name | 4-[5-methyl-3-oxo-2-(5-sulfanyl-2-pyridinyl)-1H-pyrazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 156860155 |
| Molecular Formula | C16H12N4OS |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[5-methyl-3-oxo-2-(5-sulfanyl-2-pyridinyl)-1H-pyrazol-4-yl]benzonitrile |
| SMILES | Cc1[nH]n(-c2ccc(S)cn2)c(=O)c1-c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H12N4OS/c1-10-15(12-4-2-11(8-17)3-5-12)16(21)20(19-10)14-7-6-13(22)9-18-14/h2-7,9,19,22H,1H3 |
| InChIKey | GFZGIKKGTBLTCG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|