C18H18N6O3S — CID 168752694
5-(dimethylsulfamoylamino)-2-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine (PubChem CID 168752694) has the molecular formula C18H18N6O3S and a molecular weight of 398.45 g/mol. Its IUPAC name is 5-(dimethylsulfamoylamino)-2-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine.
| Compound Name | 5-(dimethylsulfamoylamino)-2-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine |
|---|---|
| PubChem CID | 168752694 |
| Molecular Formula | C18H18N6O3S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 5-(dimethylsulfamoylamino)-2-[4-(4-isocyanophenyl)-5-methyl-3-oxo-1H-pyrazol-2-yl]pyridine |
| SMILES | [C-]#[N+]c1ccc(-c2c(C)[nH]n(-c3ccc(NS(=O)(=O)N(C)C)cn3)c2=O)cc1 |
| InChI | InChI=1S/C18H18N6O3S/c1-12-17(13-5-7-14(19-2)8-6-13)18(25)24(21-12)16-10-9-15(11-20-16)22-28(26,27)23(3)4/h5-11,21-22H,1,3-4H3 |
| InChIKey | BTMGIFLTFDNJPT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|