C22H26F19N2O6+ — CID 102313539
trimethyl-[3-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoyl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propyl]azanium (PubChem CID 102313539) has the molecular formula C22H26F19N2O6+ and a molecular weight of 775.42 g/mol. Its IUPAC name is trimethyl-[3-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoyl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propyl]azanium.
| Compound Name | trimethyl-[3-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoyl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propyl]azanium |
|---|---|
| PubChem CID | 102313539 |
| Molecular Formula | C22H26F19N2O6+ |
| Molecular Weight | 775.42 g/mol |
| Exact Mass | 775.15 |
| IUPAC Name | trimethyl-[3-[2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoyl-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]propyl]azanium |
| SMILES | C[N+](C)(C)CCCN(C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26F19N2O6/c1-43(2,3)6-4-5-42(12-11(47)10(46)9(45)8(7-44)49-12)13(48)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)21(37,38)22(39,40)41/h8-12,44-47H,4-7H2,1-3H3/q+1/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | GQIACHHLKGYTNO-RMPHRYRLSA-N |
| XLogP | 3.36 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|