C14H15F16N2O2+ — CID 159941703
3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]oxypropyl-trimethylazanium (PubChem CID 159941703) has the molecular formula C14H15F16N2O2+ and a molecular weight of 547.25 g/mol. Its IUPAC name is 3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]oxypropyl-trimethylazanium.
| Compound Name | 3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]oxypropyl-trimethylazanium |
|---|---|
| PubChem CID | 159941703 |
| Molecular Formula | C14H15F16N2O2+ |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | 3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]oxypropyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCON(F)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H15F16N2O2/c1-32(2,3)5-4-6-34-31(30)7(33)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)29/h4-6H2,1-3H3/q+1 |
| InChIKey | JXPHNDHAVRJHCM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|