C12H4F22N2O — CID 162538905
N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylamino)propyl]octanamide (PubChem CID 162538905) has the molecular formula C12H4F22N2O and a molecular weight of 610.13 g/mol. Its IUPAC name is N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylamino)propyl]octanamide.
| Compound Name | N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylamino)propyl]octanamide |
|---|---|
| PubChem CID | 162538905 |
| Molecular Formula | C12H4F22N2O |
| Molecular Weight | 610.13 g/mol |
| Exact Mass | 610.00 |
| IUPAC Name | N,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-hexadecafluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylamino)propyl]octanamide |
| SMILES | CNC(F)(F)C(F)(F)C(F)(F)N(F)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H4F22N2O/c1-35-11(30,31)9(25,26)12(32,33)36(34)2(37)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)10(27,28)29/h35H,1H3 |
| InChIKey | PJGAAKVPZZMBLR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.13 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|