C18F39IN2O — CID 172712031
[1,1,2,2,3,3-hexafluoro-3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoyl)amino]propyl]-tris(trifluoromethyl)azanium iodide (PubChem CID 172712031) has the molecular formula C18F39IN2O and a molecular weight of 1128.04 g/mol. Its IUPAC name is [1,1,2,2,3,3-hexafluoro-3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoyl)amino]propyl]-tris(trifluoromethyl)azanium iodide.
| Compound Name | [1,1,2,2,3,3-hexafluoro-3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoyl)amino]propyl]-tris(trifluoromethyl)azanium iodide |
|---|---|
| PubChem CID | 172712031 |
| Molecular Formula | C18F39IN2O |
| Molecular Weight | 1128.04 g/mol |
| Exact Mass | 1127.84 |
| IUPAC Name | [1,1,2,2,3,3-hexafluoro-3-[fluoro(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoyl)amino]propyl]-tris(trifluoromethyl)azanium iodide |
| SMILES | O=C(N(F)C(F)(F)C(F)(F)C(F)(F)[N+](C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C18F39N2O.HI/c19-2(20,1(60)58(57)14(44,45)12(39,40)15(46,47)59(16(48,49)50,17(51,52)53)18(54,55)56)3(21,22)4(23,24)5(25,26)6(27,28)7(29,30)8(31,32)9(33,34)10(35,36)11(37,38)13(41,42)43;/h;1H/q+1;/p-1 |
| InChIKey | FJKWNKULXDGWLS-UHFFFAOYSA-M |
| XLogP | 8.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.04 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|