C15F34N+ — CID 87628816
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl-tris(trifluoromethyl)azanium (PubChem CID 87628816) has the molecular formula C15F34N+ and a molecular weight of 840.10 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl-tris(trifluoromethyl)azanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl-tris(trifluoromethyl)azanium |
|---|---|
| PubChem CID | 87628816 |
| Molecular Formula | C15F34N+ |
| Molecular Weight | 840.10 g/mol |
| Exact Mass | 839.95 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecyl-tris(trifluoromethyl)azanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+](C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15F34N/c16-1(17,3(20,21)5(24,25)7(28,29)9(32,33)11(36,37)38)2(18,19)4(22,23)6(26,27)8(30,31)10(34,35)12(39,40)50(13(41,42)43,14(44,45)46)15(47,48)49/q+1 |
| InChIKey | NEFZFECXVSZRJN-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.10 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|