C9BrF22N — CID 163366276
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl-tris(trifluoromethyl)azanium bromide (PubChem CID 163366276) has the molecular formula C9BrF22N and a molecular weight of 619.97 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl-tris(trifluoromethyl)azanium bromide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl-tris(trifluoromethyl)azanium bromide |
|---|---|
| PubChem CID | 163366276 |
| Molecular Formula | C9BrF22N |
| Molecular Weight | 619.97 g/mol |
| Exact Mass | 618.89 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl-tris(trifluoromethyl)azanium bromide |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+](C(F)(F)F)(C(F)(F)F)C(F)(F)F.[Br-] |
| InChI | InChI=1S/C9F22N.BrH/c10-1(11,3(14,15)5(18,19)20)2(12,13)4(16,17)6(21,22)32(7(23,24)25,8(26,27)28)9(29,30)31;/h;1H/q+1;/p-1 |
| InChIKey | ZELJAPLRFHOXND-UHFFFAOYSA-M |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.97 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|