C8F20N+ — CID 87970147
difluoro-(1,1,2,2,2-pentafluoroethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium (PubChem CID 87970147) has the molecular formula C8F20N+ and a molecular weight of 490.06 g/mol. Its IUPAC name is difluoro-(1,1,2,2,2-pentafluoroethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium.
| Compound Name | difluoro-(1,1,2,2,2-pentafluoroethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium |
|---|---|
| PubChem CID | 87970147 |
| Molecular Formula | C8F20N+ |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 489.97 |
| IUPAC Name | difluoro-(1,1,2,2,2-pentafluoroethyl)-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+](F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F20N/c9-1(10,3(13,14)5(17,18)19)2(11,12)4(15,16)7(23,24)29(27,28)8(25,26)6(20,21)22/q+1 |
| InChIKey | AXNZFVKENCBMNU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|