C4F12N+ — CID 87372234
trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azanium (PubChem CID 87372234) has the molecular formula C4F12N+ and a molecular weight of 290.03 g/mol. Its IUPAC name is trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azanium.
| Compound Name | trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azanium |
|---|---|
| PubChem CID | 87372234 |
| Molecular Formula | C4F12N+ |
| Molecular Weight | 290.03 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | trifluoro(1,1,2,2,3,3,4,4,4-nonafluorobutyl)azanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+](F)(F)F |
| InChI | InChI=1S/C4F12N/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/q+1 |
| InChIKey | XNLXQMHGIJLQEQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.03 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|