C13F32NSi+ — CID 172816411
difluoro-[1,1,2,2,3,3,3-heptafluoropropyl-bis(1,1,2,2,2-pentafluoroethyl)silyl]-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium (PubChem CID 172816411) has the molecular formula C13F32NSi+ and a molecular weight of 806.17 g/mol. Its IUPAC name is difluoro-[1,1,2,2,3,3,3-heptafluoropropyl-bis(1,1,2,2,2-pentafluoroethyl)silyl]-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium.
| Compound Name | difluoro-[1,1,2,2,3,3,3-heptafluoropropyl-bis(1,1,2,2,2-pentafluoroethyl)silyl]-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium |
|---|---|
| PubChem CID | 172816411 |
| Molecular Formula | C13F32NSi+ |
| Molecular Weight | 806.17 g/mol |
| Exact Mass | 805.93 |
| IUPAC Name | difluoro-[1,1,2,2,3,3,3-heptafluoropropyl-bis(1,1,2,2,2-pentafluoroethyl)silyl]-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)azanium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+](F)(F)[Si](C(F)(F)C(F)(F)F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13F32NSi/c14-1(15,3(18,19)6(24,25)26)2(16,17)4(20,21)10(36,37)46(44,45)47(12(40,41)8(30,31)32,13(42,43)9(33,34)35)11(38,39)5(22,23)7(27,28)29/q+1 |
| InChIKey | SWFQOOGCQNDKGH-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.17 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|