C17HF36N2O+ — CID 175334858
[1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecanoylamino)propyl]-tris(trifluoromethyl)azanium (PubChem CID 175334858) has the molecular formula C17HF36N2O+ and a molecular weight of 933.14 g/mol. Its IUPAC name is [1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecanoylamino)propyl]-tris(trifluoromethyl)azanium.
| Compound Name | [1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecanoylamino)propyl]-tris(trifluoromethyl)azanium |
|---|---|
| PubChem CID | 175334858 |
| Molecular Formula | C17HF36N2O+ |
| Molecular Weight | 933.14 g/mol |
| Exact Mass | 932.95 |
| IUPAC Name | [1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-henicosafluoroundecanoylamino)propyl]-tris(trifluoromethyl)azanium |
| SMILES | O=C(NC(F)(F)C(F)(F)C(F)(F)[N+](C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17F36N2O/c18-2(19,1(56)54-13(41,42)11(36,37)14(43,44)55(15(45,46)47,16(48,49)50)17(51,52)53)3(20,21)4(22,23)5(24,25)6(26,27)7(28,29)8(30,31)9(32,33)10(34,35)12(38,39)40/p+1 |
| InChIKey | MIHSTRJUIZHBCF-UHFFFAOYSA-O |
| XLogP | 10.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.14 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|