C13H10ClF16NO — CID 3532396
N-tert-butyl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 3532396) has the molecular formula C13H10ClF16NO and a molecular weight of 535.65 g/mol. Its IUPAC name is N-tert-butyl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | N-tert-butyl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 3532396 |
| Molecular Formula | C13H10ClF16NO |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | N-tert-butyl-9-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | CC(C)(C)NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C13H10ClF16NO/c1-5(2,3)31-4(32)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(14,29)30/h1-3H3,(H,31,32) |
| InChIKey | INQVIESXGZKNCM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|