C21H19N5O3 — CID 102314420
2-azido-6,7-dimethoxy-4-(4-methoxyphenyl)-1-methylbenzo[f]benzimidazole (PubChem CID 102314420) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 2-azido-6,7-dimethoxy-4-(4-methoxyphenyl)-1-methylbenzo[f]benzimidazole.
| Compound Name | 2-azido-6,7-dimethoxy-4-(4-methoxyphenyl)-1-methylbenzo[f]benzimidazole |
|---|---|
| PubChem CID | 102314420 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-azido-6,7-dimethoxy-4-(4-methoxyphenyl)-1-methylbenzo[f]benzimidazole |
| SMILES | COc1ccc(-c2c3cc(OC)c(OC)cc3cc3c2nc(N=[N+]=[N-])n3C)cc1 |
| InChI | InChI=1S/C21H19N5O3/c1-26-16-9-13-10-17(28-3)18(29-4)11-15(13)19(20(16)23-21(26)24-25-22)12-5-7-14(27-2)8-6-12/h5-11H,1-4H3 |
| InChIKey | WWJGMDVGWXKXDJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|