C22H20O5 — CID 160984068
4-(3,5-dimethoxyphenyl)-6,7-dimethoxybenzo[f][2]benzofuran (PubChem CID 160984068) has the molecular formula C22H20O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-6,7-dimethoxybenzo[f][2]benzofuran.
| Compound Name | 4-(3,5-dimethoxyphenyl)-6,7-dimethoxybenzo[f][2]benzofuran |
|---|---|
| PubChem CID | 160984068 |
| Molecular Formula | C22H20O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-6,7-dimethoxybenzo[f][2]benzofuran |
| SMILES | COc1cc(OC)cc(-c2c3cocc3cc3cc(OC)c(OC)cc23)c1 |
| InChI | InChI=1S/C22H20O5/c1-23-16-6-14(7-17(9-16)24-2)22-18-10-21(26-4)20(25-3)8-13(18)5-15-11-27-12-19(15)22/h5-12H,1-4H3 |
| InChIKey | SZWRZFJREGAOCR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |