C22H17As — CID 102314687
10-phenyl-10-arsatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene (PubChem CID 102314687) has the molecular formula C22H17As and a molecular weight of 356.30 g/mol. Its IUPAC name is 10-phenyl-10-arsatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene.
| Compound Name | 10-phenyl-10-arsatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 102314687 |
| Molecular Formula | C22H17As |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 10-phenyl-10-arsatricyclo[11.4.0.02,7]heptadeca-1(17),2,4,6,8,11,13,15-octaene |
| SMILES | C1=C\[As](c2ccccc2)/C=C\c2ccccc2-c2ccccc2/1 |
| InChI | InChI=1S/C22H17As/c1-2-10-20(11-3-1)23-16-14-18-8-4-6-12-21(18)22-13-7-5-9-19(22)15-17-23/h1-17H/b16-14-,17-15- |
| InChIKey | OEQNVFSAQHNOEA-RYOQUFEFSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|