C32H19ClF3NO — CID 102314758
2-(4-chlorophenyl)-4,5,7-trifluoro-N,N,3-triphenyl-1-benzofuran-6-amine (PubChem CID 102314758) has the molecular formula C32H19ClF3NO and a molecular weight of 525.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4,5,7-trifluoro-N,N,3-triphenyl-1-benzofuran-6-amine.
| Compound Name | 2-(4-chlorophenyl)-4,5,7-trifluoro-N,N,3-triphenyl-1-benzofuran-6-amine |
|---|---|
| PubChem CID | 102314758 |
| Molecular Formula | C32H19ClF3NO |
| Molecular Weight | 525.96 g/mol |
| Exact Mass | 525.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4,5,7-trifluoro-N,N,3-triphenyl-1-benzofuran-6-amine |
| SMILES | Fc1c(N(c2ccccc2)c2ccccc2)c(F)c2oc(-c3ccc(Cl)cc3)c(-c3ccccc3)c2c1F |
| InChI | InChI=1S/C32H19ClF3NO/c33-22-18-16-21(17-19-22)31-25(20-10-4-1-5-11-20)26-27(34)28(35)30(29(36)32(26)38-31)37(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-19H |
| InChIKey | IKDYADVYEDWKRZ-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.96 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|