C21H42O3Si — CID 102315319
(4R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethylundec-10-enoic acid (PubChem CID 102315319) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is (4R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethylundec-10-enoic acid.
| Compound Name | (4R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethylundec-10-enoic acid |
|---|---|
| PubChem CID | 102315319 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | (4R,6S,8R)-3-[tert-butyl(dimethyl)silyl]oxy-4,6,8,10-tetramethylundec-10-enoic acid |
| SMILES | C=C(C)C[C@H](C)C[C@H](C)C[C@@H](C)C(CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-15(2)11-16(3)12-17(4)13-18(5)19(14-20(22)23)24-25(9,10)21(6,7)8/h16-19H,1,11-14H2,2-10H3,(H,22,23)/t16-,17-,18+,19?/m0/s1 |
| InChIKey | RCWUUGDCDHMGOP-HTUJPFKRSA-N |
| XLogP | 6.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|