C12H15N5O3 — CID 102315640
N-(6-methoxy-4-oxopteridin-3-yl)-2,2-dimethylpropanamide (PubChem CID 102315640) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(6-methoxy-4-oxopteridin-3-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-methoxy-4-oxopteridin-3-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 102315640 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(6-methoxy-4-oxopteridin-3-yl)-2,2-dimethylpropanamide |
| SMILES | COc1cnc2ncn(NC(=O)C(C)(C)C)c(=O)c2n1 |
| InChI | InChI=1S/C12H15N5O3/c1-12(2,3)11(19)16-17-6-14-9-8(10(17)18)15-7(20-4)5-13-9/h5-6H,1-4H3,(H,16,19) |
| InChIKey | OZZWUGUSJIHZAI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |