C20H20O5 — CID 102318773
[(1R,4S,5S)-4,5-dihydroxy-3-(phenylmethoxymethyl)cyclopent-2-en-1-yl] benzoate (PubChem CID 102318773) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(1R,4S,5S)-4,5-dihydroxy-3-(phenylmethoxymethyl)cyclopent-2-en-1-yl] benzoate.
| Compound Name | [(1R,4S,5S)-4,5-dihydroxy-3-(phenylmethoxymethyl)cyclopent-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 102318773 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | [(1R,4S,5S)-4,5-dihydroxy-3-(phenylmethoxymethyl)cyclopent-2-en-1-yl] benzoate |
| SMILES | O=C(O[C@@H]1C=C(COCc2ccccc2)[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H20O5/c21-18-16(13-24-12-14-7-3-1-4-8-14)11-17(19(18)22)25-20(23)15-9-5-2-6-10-15/h1-11,17-19,21-22H,12-13H2/t17-,18+,19-/m1/s1 |
| InChIKey | HGRLEQQFTHJMPS-CEXWTWQISA-N |
| XLogP | 2.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|