C30H32O8 — CID 71818348
[(3R,4S,5S,6R)-4,6-dihydroxy-3,5-bis[(4-methoxyphenyl)methoxy]cyclohexen-1-yl]methyl benzoate (PubChem CID 71818348) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-4,6-dihydroxy-3,5-bis[(4-methoxyphenyl)methoxy]cyclohexen-1-yl]methyl benzoate.
| Compound Name | [(3R,4S,5S,6R)-4,6-dihydroxy-3,5-bis[(4-methoxyphenyl)methoxy]cyclohexen-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 71818348 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [(3R,4S,5S,6R)-4,6-dihydroxy-3,5-bis[(4-methoxyphenyl)methoxy]cyclohexen-1-yl]methyl benzoate |
| SMILES | COc1ccc(COC2C=C(COC(=O)c3ccccc3)[C@@H](O)[C@H](OCc3ccc(OC)cc3)[C@H]2O)cc1 |
| InChI | InChI=1S/C30H32O8/c1-34-24-12-8-20(9-13-24)17-36-26-16-23(19-38-30(33)22-6-4-3-5-7-22)27(31)29(28(26)32)37-18-21-10-14-25(35-2)15-11-21/h3-16,26-29,31-32H,17-19H2,1-2H3/t26?,27-,28+,29+/m1/s1 |
| InChIKey | SGUDHBNXRJISMS-FDYVXIQZSA-N |
| XLogP | 3.69 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|