C29H26O7 — CID 155567696
[(1R,2R,4aR,9aR)-1-benzoyloxy-2-hydroxy-7-methoxy-2,4a,9,9a-tetrahydro-1H-xanthen-3-yl]methyl benzoate (PubChem CID 155567696) has the molecular formula C29H26O7 and a molecular weight of 486.52 g/mol. Its IUPAC name is [(1R,2R,4aR,9aR)-1-benzoyloxy-2-hydroxy-7-methoxy-2,4a,9,9a-tetrahydro-1H-xanthen-3-yl]methyl benzoate.
| Compound Name | [(1R,2R,4aR,9aR)-1-benzoyloxy-2-hydroxy-7-methoxy-2,4a,9,9a-tetrahydro-1H-xanthen-3-yl]methyl benzoate |
|---|---|
| PubChem CID | 155567696 |
| Molecular Formula | C29H26O7 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | [(1R,2R,4aR,9aR)-1-benzoyloxy-2-hydroxy-7-methoxy-2,4a,9,9a-tetrahydro-1H-xanthen-3-yl]methyl benzoate |
| SMILES | COc1ccc2c(c1)C[C@H]1[C@@H](OC(=O)c3ccccc3)[C@H](O)C(COC(=O)c3ccccc3)=C[C@H]1O2 |
| InChI | InChI=1S/C29H26O7/c1-33-22-12-13-24-20(14-22)15-23-25(35-24)16-21(17-34-28(31)18-8-4-2-5-9-18)26(30)27(23)36-29(32)19-10-6-3-7-11-19/h2-14,16,23,25-27,30H,15,17H2,1H3/t23-,25-,26-,27-/m1/s1 |
| InChIKey | NCNZUIZIXIAEKJ-MIRJVGOZSA-N |
| XLogP | 4.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|