C19H26N2O3 — CID 102320437
(4aR,6R,7R,8aR)-7-hydroxy-6-(4-phenylpiperidin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[b][1,4]oxazin-3-one (PubChem CID 102320437) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (4aR,6R,7R,8aR)-7-hydroxy-6-(4-phenylpiperidin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[b][1,4]oxazin-3-one.
| Compound Name | (4aR,6R,7R,8aR)-7-hydroxy-6-(4-phenylpiperidin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 102320437 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (4aR,6R,7R,8aR)-7-hydroxy-6-(4-phenylpiperidin-1-yl)-4a,5,6,7,8,8a-hexahydro-4H-benzo[b][1,4]oxazin-3-one |
| SMILES | O=C1CO[C@@H]2C[C@@H](O)C(N3CCC(c4ccccc4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C19H26N2O3/c22-17-11-18-15(20-19(23)12-24-18)10-16(17)21-8-6-14(7-9-21)13-4-2-1-3-5-13/h1-5,14-18,22H,6-12H2,(H,20,23)/t15-,16?,17-,18-/m1/s1 |
| InChIKey | UPTKJGWUOGWBOJ-PFMBNVRQSA-N |
| XLogP | 1.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |