C24H22N2O6 — CID 102321432
ethyl 2-(1,3-dioxan-2-ylidene)-2-[6-methyl-2-(4-nitrophenyl)quinolin-4-yl]acetate (PubChem CID 102321432) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxan-2-ylidene)-2-[6-methyl-2-(4-nitrophenyl)quinolin-4-yl]acetate.
| Compound Name | ethyl 2-(1,3-dioxan-2-ylidene)-2-[6-methyl-2-(4-nitrophenyl)quinolin-4-yl]acetate |
|---|---|
| PubChem CID | 102321432 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | ethyl 2-(1,3-dioxan-2-ylidene)-2-[6-methyl-2-(4-nitrophenyl)quinolin-4-yl]acetate |
| SMILES | CCOC(=O)C(=C1OCCCO1)c1cc(-c2ccc([N+](=O)[O-])cc2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C24H22N2O6/c1-3-30-23(27)22(24-31-11-4-12-32-24)19-14-21(16-6-8-17(9-7-16)26(28)29)25-20-10-5-15(2)13-18(19)20/h5-10,13-14H,3-4,11-12H2,1-2H3 |
| InChIKey | DMPAMABJIVEDDK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|