C22H21NO2S3 — CID 16732820
ethyl 2-(1,3-dithian-2-ylidene)-2-(6-methyl-2-thiophen-2-ylquinolin-4-yl)acetate (PubChem CID 16732820) has the molecular formula C22H21NO2S3 and a molecular weight of 427.62 g/mol. Its IUPAC name is ethyl 2-(1,3-dithian-2-ylidene)-2-(6-methyl-2-thiophen-2-ylquinolin-4-yl)acetate.
| Compound Name | ethyl 2-(1,3-dithian-2-ylidene)-2-(6-methyl-2-thiophen-2-ylquinolin-4-yl)acetate |
|---|---|
| PubChem CID | 16732820 |
| Molecular Formula | C22H21NO2S3 |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | ethyl 2-(1,3-dithian-2-ylidene)-2-(6-methyl-2-thiophen-2-ylquinolin-4-yl)acetate |
| SMILES | CCOC(=O)C(=C1SCCCS1)c1cc(-c2cccs2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C22H21NO2S3/c1-3-25-21(24)20(22-27-10-5-11-28-22)16-13-18(19-6-4-9-26-19)23-17-8-7-14(2)12-15(16)17/h4,6-9,12-13H,3,5,10-11H2,1-2H3 |
| InChIKey | BSMLRJYJTXLLDD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|