C12H19N — CID 102321768
N-(3-methyl-5-propylcyclopenta-1,4-dien-1-yl)propan-2-imine (PubChem CID 102321768) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is N-(3-methyl-5-propylcyclopenta-1,4-dien-1-yl)propan-2-imine.
| Compound Name | N-(3-methyl-5-propylcyclopenta-1,4-dien-1-yl)propan-2-imine |
|---|---|
| PubChem CID | 102321768 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N-(3-methyl-5-propylcyclopenta-1,4-dien-1-yl)propan-2-imine |
| SMILES | CCCC1=CC(C)C=C1N=C(C)C |
| InChI | InChI=1S/C12H19N/c1-5-6-11-7-10(4)8-12(11)13-9(2)3/h7-8,10H,5-6H2,1-4H3 |
| InChIKey | AYBDLYLSQLRASR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|